cas: 173690-50-1 — see every product listed under this CAS number, including other names
(1R,4R)-4-(((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)methyl)cyclohexanecarboxylic acid, 95%, 95% (CAS 173690-50-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Z51-250mg |
| cas | 173690-50-1 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 630.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]methyl]cyclohexane-1-carboxylic acid (CAS 173690-50-1) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: 4-[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]methyl]cyclohexane-1-carboxylic acid. InChIKey: RUPNBZQCCALWQZ-UHFFFAOYSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 4-[[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | RUPNBZQCCALWQZ-UHFFFAOYSA-N |
| SMILES | CN(CC1CCC(CC1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)