Products 683217-61-0

CAS 683217-61-0 is the registry number for 2-Cyclohexyl-3-(9h-fluoren-9-ylmethoxycarbonylamino)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 683217-61-0) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: 2-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: MYCOAJZXTGFHDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC24H27NO4
Molecular weight393.5 g/mol
IUPAC name2-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
InChIKeyMYCOAJZXTGFHDZ-UHFFFAOYSA-N
SMILESC1CCC(CC1)C(CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O

Computed by PubChem (NCBI)