cas: 165947-29-5 — see every product listed under this CAS number, including other names
(1R,4R)-4-(((tert-Butoxycarbonyl)(methyl)amino)methyl)cyclohexanecarboxylic acid, 97% (CAS 165947-29-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A153181-25g |
| cas | 165947-29-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 7178.92 Pln | |
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 799.74 Pln | |
| Fluorochem | 5g | 3074.98 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]cyclohexane-1-carboxylic acid (CAS 165947-29-5) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]cyclohexane-1-carboxylic acid. InChIKey: HCDBMQKQNARMBU-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | HCDBMQKQNARMBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)