CAS 1013980-15-8 appears in our catalog under these names: Cis-2-tert-butoxycarbonylamino-cyclooctanecarboxylic acid, 95%, cis-2-tert-Butoxycarbonylamino-cyclooctanecarboxylic Acid. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
Cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclooctane-1-carboxylic acid (CAS 1013980-15-8) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclooctane-1-carboxylic acid. InChIKey: XCJDZYKLPCSUNZ-WDEREUQCSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclooctane-1-carboxylic acid |
| InChIKey | XCJDZYKLPCSUNZ-WDEREUQCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCCCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)