cas: 198835-05-1 — see every product listed under this CAS number, including other names
(1R,4S,6S)-rel-tert-Butyl 6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate 97% (CAS 198835-05-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116366-100mg |
| cas | 198835-05-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1176.94 Pln | |
| Ambeed | 250mg | 1838.88 Pln | |
| Ambeed | 1g | 4492.19 Pln | |
| Ambeed | 5g | 13342.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A116366 |
Tert-butyl (1R,4S,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 198835-05-1) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1R,4S,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: PABFVGKPNHVSCG-YIZRAAEISA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1R,4S,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | PABFVGKPNHVSCG-YIZRAAEISA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1[C@H](C2)O |
Computed by PubChem (NCBI)