CAS 168960-18-7 is the registry number for tert-Butyl ((1r,4s)-4-(hydroxymethyl)cyclopent-2-en-1-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate (CAS 168960-18-7) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl N-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate. InChIKey: MVIWPMBRXBNBDX-BDAKNGLRSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl N-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate |
| InChIKey | MVIWPMBRXBNBDX-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](C=C1)CO |
Computed by PubChem (NCBI)