cas: 1417789-72-0 — see every product listed under this CAS number, including other names
(1R,6S)-3-Boc-3,7-diazabicyclo[4.2.0]octane, >95%, >95% (CAS 1417789-72-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110X3D-100mg |
| cas | 1417789-72-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1701.20 Pln | |
| Chemat | 250mg | 2680.40 Pln | |
| Chemat | 1g | 6611.60 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (1R,6S)-3,7-diazabicyclo[4.2.0]octane-3-carboxylate (CAS 1417789-72-0) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1R,6S)-3,7-diazabicyclo[4.2.0]octane-3-carboxylate. InChIKey: TUIAJQPTVCSWOB-BDAKNGLRSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1R,6S)-3,7-diazabicyclo[4.2.0]octane-3-carboxylate |
| InChIKey | TUIAJQPTVCSWOB-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](C1)CN2 |
Computed by PubChem (NCBI)