Products 885271-67-0

CAS 885271-67-0 is the registry number for tert-Butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate (CAS 885271-67-0) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate. InChIKey: TUIAJQPTVCSWOB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20N2O2
Molecular weight212.29 g/mol
IUPAC nametert-butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate
InChIKeyTUIAJQPTVCSWOB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2C(C1)CN2

Computed by PubChem (NCBI)