cas: 79549-89-6 — see every product listed under this CAS number, including other names
(1R,8S,9r,Z)-Ethyl bicyclo[6.1.0]non-4-ene-9-carboxylate, 97% (CAS 79549-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F551776-100MG |
| cas | 79549-89-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 1g | 2205.49 Pln | |
| Fluorochem | 5g | 6792.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl (1S,4Z,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate (CAS 79549-89-6) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: ethyl (1S,4Z,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate. InChIKey: BAOUWGVQCUYLAA-ACNMEMRISA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | ethyl (1S,4Z,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate |
| InChIKey | BAOUWGVQCUYLAA-ACNMEMRISA-N |
| SMILES | CCOC(=O)C1[C@H]2[C@@H]1CC/C=C\CC2 |
Computed by PubChem (NCBI)