CAS 14393-45-4 appears in our catalog under these names: (2E)-3-(2,6,6-Trimethylcyclohex-1-en-1-yl)prop-2-enoic acid, 95%, (E)-3-(2,6,6-Trimethylcyclohex-1-en-1-yl)acrylic acid, 98%, β–Ionone Acid, β-Ionone acid, 98.78%. Offered by: Combi-blocks, AmBeed, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 5g, 10mg, 5mg, 50mg, 10 mg.
(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid (CAS 14393-45-4) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid. InChIKey: RCVGWZAQWMJQHG-VOTSOKGWSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid |
| InChIKey | RCVGWZAQWMJQHG-VOTSOKGWSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)