cas: 1902258-10-9 — see every product listed under this CAS number, including other names
(1S)-2,2-diphenyl-1-(pyrrolidin-2-yl)ethan-1-ol, 97% (CAS 1902258-10-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F723451-250MG |
| cas | 1902258-10-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 190.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-2,2-diphenyl-1-pyrrolidin-2-ylethanol (CAS 1902258-10-9) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: (1S)-2,2-diphenyl-1-pyrrolidin-2-ylethanol. InChIKey: VSYNDOLFWJVQNK-UHUGOGIASA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | (1S)-2,2-diphenyl-1-pyrrolidin-2-ylethanol |
| InChIKey | VSYNDOLFWJVQNK-UHUGOGIASA-N |
| SMILES | C1CC(NC1)[C@H](C(C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)