Products 2227199-05-3
CAS 2227199-05-3 appears in our catalog under these names: (3R)-1-Benzhydryl-2,2-dimethyl-azetidin-3-ol, 95%, (3R)-1-benzhydryl-2,2-dimethyl-azetidin-3-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(3R)-1-benzhydryl-2,2-dimethylazetidin-3-ol (CAS 2227199-05-3) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: (3R)-1-benzhydryl-2,2-dimethylazetidin-3-ol. InChIKey: YRDDKKNUZORKDG-MRXNPFEDSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | (3R)-1-benzhydryl-2,2-dimethylazetidin-3-ol |
| InChIKey | YRDDKKNUZORKDG-MRXNPFEDSA-N |
| SMILES | CC1([C@@H](CN1C(C2=CC=CC=C2)C3=CC=CC=C3)O)C |
Computed by PubChem (NCBI)