Products 66254-55-5

CAS 66254-55-5 appears in our catalog under these names: (1S)-AMPPA, (1S)-AMPPA, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x10mg, 1x1ml.

Structural formula: {0} (CAS {1})

[(1S)-1-amino-2-methylpropyl]phosphonic acid (CAS 66254-55-5) is a chemical compound with the molecular formula C4H12NO3P and a molecular weight of 153.12 g/mol. IUPAC name: [(1S)-1-amino-2-methylpropyl]phosphonic acid. InChIKey: DGSLPJDIFKVSIB-BYPYZUCNSA-N.

Identity
Molecular formulaC4H12NO3P
Molecular weight153.12 g/mol
IUPAC name[(1S)-1-amino-2-methylpropyl]phosphonic acid
InChIKeyDGSLPJDIFKVSIB-BYPYZUCNSA-N
SMILESCC(C)[C@@H](N)P(=O)(O)O

Computed by PubChem (NCBI)