cas: 445479-01-6 — see every product listed under this CAS number, including other names
(1S,2R)-2-Amino-1-(Boc-amino)cyclopentane 97% (CAS 445479-01-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A514202-250mg |
| cas | 445479-01-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2628.75 Pln | |
| Ambeed | 25g | 9036.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A514202 |
Tert-butyl N-[(1S,2R)-2-aminocyclopentyl]carbamate (CAS 445479-01-6) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-aminocyclopentyl]carbamate. InChIKey: PAXDIBGWURAVIH-SFYZADRCSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-aminocyclopentyl]carbamate |
| InChIKey | PAXDIBGWURAVIH-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@H]1N |
Computed by PubChem (NCBI)