cas: 445479-01-6 — see every product listed under this CAS number, including other names
tert-Butyl N-[(1S,2R)-2-aminocyclopentyl]carbamate, 97% (CAS 445479-01-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094346-250MG |
| cas | 445479-01-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 784.12 Pln | |
| Fluorochem | 5g | 2543.91 Pln | |
| Fluorochem | 10g | 5032.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(1S,2R)-2-aminocyclopentyl]carbamate (CAS 445479-01-6) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-aminocyclopentyl]carbamate. InChIKey: PAXDIBGWURAVIH-SFYZADRCSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-aminocyclopentyl]carbamate |
| InChIKey | PAXDIBGWURAVIH-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@H]1N |
Computed by PubChem (NCBI)