cas: 207129-36-0 — see every product listed under this CAS number, including other names
(1S,2R,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octane-2-methanol, 95.0%, 95.0% (CAS 207129-36-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113IUU-100mg |
| cas | 207129-36-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 1g | 3102.80 Pln |
| purity | 95.0% |
|---|---|
| delivery time | 3 weeks |
[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol (CAS 207129-36-0) is a chemical compound with the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. IUPAC name: [(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol. InChIKey: GAFZBOMPQVRGKU-LPEHRKFASA-N.
| Molecular formula | C10H17NO |
|---|---|
| Molecular weight | 167.25 g/mol |
| IUPAC name | [(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| InChIKey | GAFZBOMPQVRGKU-LPEHRKFASA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CO |
Computed by PubChem (NCBI)