cas: 5157-89-1 — see every product listed under this CAS number, including other names
(1S,2R,5S)-2-isopropyl-5-methylcyclohexyl acetate, ≥98%(GC), ≥98%(GC) (CAS 5157-89-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BHZ-250mg |
| cas | 5157-89-1 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 347.60 Pln |
| purity | ≥98%(GC) |
|---|---|
| delivery time | 3 weeks |
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] acetate (CAS 5157-89-1) is a chemical compound with the molecular formula C12H22O2 and a molecular weight of 198.30 g/mol. IUPAC name: [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] acetate. InChIKey: XHXUANMFYXWVNG-WCQGTBRESA-N.
| Molecular formula | C12H22O2 |
|---|---|
| Molecular weight | 198.30 g/mol |
| IUPAC name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] acetate |
| InChIKey | XHXUANMFYXWVNG-WCQGTBRESA-N |
| SMILES | C[C@H]1CC[C@@H]([C@H](C1)OC(=O)C)C(C)C |
Computed by PubChem (NCBI)