CAS 146502-80-9 appears in our catalog under these names: (1R,2R,5S)-Neomenthyl Acetate, (-)-Neomenthyl Acetate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] acetate (CAS 146502-80-9) is a chemical compound with the molecular formula C12H22O2 and a molecular weight of 198.30 g/mol. IUPAC name: [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] acetate. InChIKey: XHXUANMFYXWVNG-MVWJERBFSA-N.
| Molecular formula | C12H22O2 |
|---|---|
| Molecular weight | 198.30 g/mol |
| IUPAC name | [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] acetate |
| InChIKey | XHXUANMFYXWVNG-MVWJERBFSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@@H](C1)OC(=O)C)C(C)C |
Computed by PubChem (NCBI)