cas: 175415-95-9 — see every product listed under this CAS number, including other names
(1S,2S)-2-(Ethoxycarbonyl)cyclopropanecarboxylic acid, 95%, 95% (CAS 175415-95-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AXQ2-100mg |
| cas | 175415-95-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1139.60 Pln | |
| Chemat | 250mg | 1864.40 Pln | |
| Chemat | 500mg | 2637.20 Pln | |
| Chemat | 1g | 3741.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Trans-(1S,2S)-2-ethoxycarbonylcyclopropane-1-carboxylic acid (CAS 175415-95-9) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: trans-(1S,2S)-2-ethoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: BRVQFDJETHFEQY-WHFBIAKZSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | trans-(1S,2S)-2-ethoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | BRVQFDJETHFEQY-WHFBIAKZSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)