CAS 1461-97-8 appears in our catalog under these names: trans-1,2-Cyclopentanedicarboxylic acid, 97%, 97%, trans-1,2-Cyclopentanedicarboxylic acid, 95%, trans-DL-Cyclopentane-1,2-dicarboxylic acid, 98%. Offered by: Chemat, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g.
Trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid (CAS 1461-97-8) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid. InChIKey: ASJCSAKCMTWGAH-RFZPGFLSSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid |
| InChIKey | ASJCSAKCMTWGAH-RFZPGFLSSA-N |
| SMILES | C1C[C@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)