cas: 220497-66-5 — see every product listed under this CAS number, including other names
(1S,3R)-3-(Fmoc-amino)cyclopentanecarboxylicacid 95% (CAS 220497-66-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139908-100mg |
| cas | 220497-66-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 2061.38 Pln | |
| Ambeed | 25g | 6839.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A139908 |
Cis-(1S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 220497-66-5) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: cis-(1S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: BHDMUBZVWRSQOT-UONOGXRCSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | cis-(1S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | BHDMUBZVWRSQOT-UONOGXRCSA-N |
| SMILES | C1C[C@H](C[C@H]1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)