Products 1820575-02-7

CAS 1820575-02-7 is the registry number for 1-(9H-fluoren-9-ylmethyl) 2-methyl (2R)-pyrrolidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2R)-pyrrolidine-1,2-dicarboxylate (CAS 1820575-02-7) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2R)-pyrrolidine-1,2-dicarboxylate. InChIKey: UOUWERCJBDHVIP-LJQANCHMSA-N.

Identity
Molecular formulaC21H21NO4
Molecular weight351.4 g/mol
IUPAC name1-O-(9H-fluoren-9-ylmethyl) 2-O-methyl (2R)-pyrrolidine-1,2-dicarboxylate
InChIKeyUOUWERCJBDHVIP-LJQANCHMSA-N
SMILESCOC(=O)[C@H]1CCCN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)