cas: 291775-53-6 — see every product listed under this CAS number, including other names
(1S,3R,4R)-2-(Tert-Butoxycarbonyl)-2-Azabicyclo[2.2.1]Heptane-3-Carboxylic Acid, 98% (CAS 291775-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch113XL8-100mg |
| cas | 291775-53-6 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 6266.00 Pln | |
| Fluorochem | 100mg | 929.90 Pln | |
| Fluorochem | 250mg | 1200.64 Pln | |
| Fluorochem | 1g | 2679.28 Pln | |
| Fluorochem | 5g | 11426.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S,3R,4R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.1]heptane-3-carboxylic acid (CAS 291775-53-6) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: (1S,3R,4R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.1]heptane-3-carboxylic acid. InChIKey: IFAMSTPTNRJBRG-HRDYMLBCSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (1S,3R,4R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
| InChIKey | IFAMSTPTNRJBRG-HRDYMLBCSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@H](C2)[C@@H]1C(=O)O |
Computed by PubChem (NCBI)