Products 1245912-12-2
CAS 1245912-12-2 appears in our catalog under these names: tert-butyl 2,2-dimethyl-4,6-dioxopiperidine-1-carboxylate, 95%, tert-Butyl 2,2-dimethyl-4,6-dioxopiperidine-1-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Tert-butyl 2,2-dimethyl-4,6-dioxopiperidine-1-carboxylate (CAS 1245912-12-2) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: tert-butyl 2,2-dimethyl-4,6-dioxopiperidine-1-carboxylate. InChIKey: GMSOKQZFTCRPDW-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | tert-butyl 2,2-dimethyl-4,6-dioxopiperidine-1-carboxylate |
| InChIKey | GMSOKQZFTCRPDW-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)CC(=O)N1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)