(1S,4S)-2-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptane dihydrochloride, 97%, 97%
cas: 2231666-14-9 — see every product listed under this CAS number, including other names
(1S,4S)-2-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptane dihydrochloride, 97%, 97% (CAS 2231666-14-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUAY-100mg |
| cas | 2231666-14-9 |
| size | 100mg |
| availability | 1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 894.80 Pln | |
| Chemat | 500mg | 1446.80 Pln | |
| Chemat | 1g | 2147.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1S,4S)-2-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CAS 2231666-14-9) is a chemical compound with the molecular formula C8H18Cl2N2O and a molecular weight of 229.14 g/mol. IUPAC name: (1S,4S)-2-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: HVJAAAVNFCLGIS-FOMWZSOGSA-N.
| Molecular formula | C8H18Cl2N2O |
|---|---|
| Molecular weight | 229.14 g/mol |
| IUPAC name | (1S,4S)-2-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | HVJAAAVNFCLGIS-FOMWZSOGSA-N |
| SMILES | COCCN1C[C@@H]2C[C@H]1CN2.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1S,4S)-2-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptane dihydrochloride, rel-(1R,4R)-2-(2-Methoxyethyl)-2,5-diazabicyclo[2.2.1]heptane dihydrochloride, (1S,4S)-2-(2-Methoxyethyl)-2,5-diazabicyclo[2.2.1]heptane diHCl, (1S,4S)-2-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptanedihydrochloride