CAS 1403763-30-3 appears in our catalog under these names: N-Methyl-n-[(3r)-oxolan-3-yl]azetidin-3-amine dihydrochloride, 95%, (R)-N-Methyl-N-(tetrahydrofuran-3-yl)-azetidin-3-amine dihydrochloride, 97%, N-methyl-N-[(3R)-oxolan-3-yl]azetidin-3-amine dihydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 500mg.
N-methyl-N-[(3R)-oxolan-3-yl]azetidin-3-amine;dihydrochloride (CAS 1403763-30-3) is a chemical compound with the molecular formula C8H18Cl2N2O and a molecular weight of 229.14 g/mol. IUPAC name: N-methyl-N-[(3R)-oxolan-3-yl]azetidin-3-amine;dihydrochloride. InChIKey: UWSMFNFSSFRRBA-XCUBXKJBSA-N.
| Molecular formula | C8H18Cl2N2O |
|---|---|
| Molecular weight | 229.14 g/mol |
| IUPAC name | N-methyl-N-[(3R)-oxolan-3-yl]azetidin-3-amine;dihydrochloride |
| InChIKey | UWSMFNFSSFRRBA-XCUBXKJBSA-N |
| SMILES | CN([C@@H]1CCOC1)C2CNC2.Cl.Cl |
Computed by PubChem (NCBI)