CAS 125224-62-6 appears in our catalog under these names: (1S,4S)-2-Methyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide, 97%, (1S,4S)-2-Methyl-2,5-diazabicyclo(2.2.1)heptane dihydrobromide, (1S,4S)-2-Methyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide, 97%, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 250mg, 1g, 100mg, 100g.
(1S,4S)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide (CAS 125224-62-6) is a chemical compound with the molecular formula C6H14Br2N2 and a molecular weight of 274.00 g/mol. IUPAC name: (1S,4S)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide. InChIKey: WLUAJCSMROZCDP-USPAICOZSA-N.
| Molecular formula | C6H14Br2N2 |
|---|---|
| Molecular weight | 274.00 g/mol |
| IUPAC name | (1S,4S)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide |
| InChIKey | WLUAJCSMROZCDP-USPAICOZSA-N |
| SMILES | CN1C[C@@H]2C[C@H]1CN2.Br.Br |
Computed by PubChem (NCBI)