CAS 125224-64-8 appears in our catalog under these names: (1R,4R)-2-Methyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide, 95%, (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 10g, 25g.
(1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide (CAS 125224-64-8) is a chemical compound with the molecular formula C6H14Br2N2 and a molecular weight of 274.00 g/mol. IUPAC name: (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide. InChIKey: WLUAJCSMROZCDP-BNTLRKBRSA-N.
| Molecular formula | C6H14Br2N2 |
|---|---|
| Molecular weight | 274.00 g/mol |
| IUPAC name | (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide |
| InChIKey | WLUAJCSMROZCDP-BNTLRKBRSA-N |
| SMILES | CN1C[C@H]2C[C@@H]1CN2.Br.Br |
Computed by PubChem (NCBI)