cas: 220204-00-2 — see every product listed under this CAS number, including other names
(2,2'-Dimethoxy-[1,1'-binaphthalene]-3,3'-diyl)diboronic acid, 98%, 98% (CAS 220204-00-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BECE-250mg |
| cas | 220204-00-2 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 477.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(3-borono-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]boronic acid (CAS 220204-00-2) is a chemical compound with the molecular formula C22H20B2O6 and a molecular weight of 402.0 g/mol. IUPAC name: [4-(3-borono-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]boronic acid. InChIKey: PNKNNZOHEMBDRL-UHFFFAOYSA-N.
| Molecular formula | C22H20B2O6 |
|---|---|
| Molecular weight | 402.0 g/mol |
| IUPAC name | [4-(3-borono-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]boronic acid |
| InChIKey | PNKNNZOHEMBDRL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2C(=C1OC)C3=C(C(=CC4=CC=CC=C43)B(O)O)OC)(O)O |
Computed by PubChem (NCBI)