CAS 220204-00-2 appears in our catalog under these names: (S)-2,2'-Dimethoxy-1,1'-binaphthalene-3,3'-diboronic acid, 95%, (2,2'-Dimethoxy-[1,1'-binaphthalene]-3,3'-diyl)diboronic acid 98%, (2,2'-Dimethoxy-[1,1'-binaphthalene]-3,3'-diyl)diboronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
[4-(3-borono-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]boronic acid (CAS 220204-00-2) is a chemical compound with the molecular formula C22H20B2O6 and a molecular weight of 402.0 g/mol. IUPAC name: [4-(3-borono-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]boronic acid. InChIKey: PNKNNZOHEMBDRL-UHFFFAOYSA-N.
| Molecular formula | C22H20B2O6 |
|---|---|
| Molecular weight | 402.0 g/mol |
| IUPAC name | [4-(3-borono-2-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-yl]boronic acid |
| InChIKey | PNKNNZOHEMBDRL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2C(=C1OC)C3=C(C(=CC4=CC=CC=C43)B(O)O)OC)(O)O |
Computed by PubChem (NCBI)