cas: 7305-59-1 — see every product listed under this CAS number, including other names
(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate, 99%(GC-MS),RG, 99%(GC-MS),RG (CAS 7305-59-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114P8V-1g |
| cas | 7305-59-1 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 390.80 Pln | |
| Chemat | 25g | 1341.20 Pln | |
| Chemat | 100g | 4446.80 Pln |
| purity | 99%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate (CAS 7305-59-1) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. IUPAC name: (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate. InChIKey: SRKDUHUULIWXFT-UHFFFAOYSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | SRKDUHUULIWXFT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2COC(O2)(C)C |
Computed by PubChem (NCBI)