CAS 7305-59-1 appears in our catalog under these names: 2,2-Dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate, 97%, (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate, 95%, 2,2-DIMETHYL-1,3-DIOXOLAN-4-YLMETHYL, 2,2-DIMETHYL-1,3-DIOXOLAN-4-YLMETHYL &, (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate, 99%(GC-MS),RG, 99%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 1g, 100g, 5g, 10g, 50G.
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate (CAS 7305-59-1) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. IUPAC name: (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate. InChIKey: SRKDUHUULIWXFT-UHFFFAOYSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | SRKDUHUULIWXFT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2COC(O2)(C)C |
Computed by PubChem (NCBI)