cas: 4960-49-0 — see every product listed under this CAS number, including other names
(2,3,6-Trichlorophenyl)methanamine 95% (CAS 4960-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A664373-100mg |
| cas | 4960-49-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1538.50 Pln | |
| Ambeed | 5g | 5727.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A664373 |
(2,3,6-trichlorophenyl)methanamine (CAS 4960-49-0) is a chemical compound with the molecular formula C7H6Cl3N and a molecular weight of 210.5 g/mol. IUPAC name: (2,3,6-trichlorophenyl)methanamine. InChIKey: BQTDSTACPKSLCW-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3N |
|---|---|
| Molecular weight | 210.5 g/mol |
| IUPAC name | (2,3,6-trichlorophenyl)methanamine |
| InChIKey | BQTDSTACPKSLCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)CN)Cl)Cl |
Computed by PubChem (NCBI)