cas: 4960-49-0 — see every product listed under this CAS number, including other names
2,3,6-Trichlorobenzenemethanamine, 95%, 95% (CAS 4960-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117ZRE-100mg |
| cas | 4960-49-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1499.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,3,6-trichlorophenyl)methanamine (CAS 4960-49-0) is a chemical compound with the molecular formula C7H6Cl3N and a molecular weight of 210.5 g/mol. IUPAC name: (2,3,6-trichlorophenyl)methanamine. InChIKey: BQTDSTACPKSLCW-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3N |
|---|---|
| Molecular weight | 210.5 g/mol |
| IUPAC name | (2,3,6-trichlorophenyl)methanamine |
| InChIKey | BQTDSTACPKSLCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)CN)Cl)Cl |
Computed by PubChem (NCBI)