cas: 1256470-41-3 — see every product listed under this CAS number, including other names
(2,4,5-Trifluorophenyl)acetic acid ethyl ester, 96% (CAS 1256470-41-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094749-1G |
| cas | 1256470-41-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 955.93 Pln | |
| Fluorochem | 25g | 4558.83 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(2,4,5-trifluorophenyl)acetate (CAS 1256470-41-3) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: ethyl 2-(2,4,5-trifluorophenyl)acetate. InChIKey: BYCOSMGZZNULDT-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | ethyl 2-(2,4,5-trifluorophenyl)acetate |
| InChIKey | BYCOSMGZZNULDT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=C1F)F)F |
Computed by PubChem (NCBI)