Products 1215279-95-0
CAS 1215279-95-0 appears in our catalog under these names: 6-(Trifluoromethoxy)-2,3-dihydro-1h-inden-1-ol, 95%, 6-(Trifluoromethoxy)-2,3-dihydro-1H-inden-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-ol (CAS 1215279-95-0) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 6-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-ol. InChIKey: BOTGRKVUUXJWSQ-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-2,3-dihydro-1H-inden-1-ol |
| InChIKey | BOTGRKVUUXJWSQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1O)C=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)