cas: 1072951-37-1 — see every product listed under this CAS number, including other names
(2,4,6-Trifluoro-3-hydroxyphenyl)boronic acid 98% (CAS 1072951-37-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175338-100mg |
| cas | 1072951-37-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 598.44 Pln | |
| Ambeed | 5g | 2695.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A175338 |
(2,4,6-trifluoro-3-hydroxyphenyl)boronic acid (CAS 1072951-37-1) is a chemical compound with the molecular formula C6H4BF3O3 and a molecular weight of 191.90 g/mol. IUPAC name: (2,4,6-trifluoro-3-hydroxyphenyl)boronic acid. InChIKey: LKUKEGVNXUPRQC-UHFFFAOYSA-N.
| Molecular formula | C6H4BF3O3 |
|---|---|
| Molecular weight | 191.90 g/mol |
| IUPAC name | (2,4,6-trifluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | LKUKEGVNXUPRQC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)F)O)F)(O)O |
Computed by PubChem (NCBI)