CAS 1072951-37-1 appears in our catalog under these names: 2,4,6-Trifluoro-3-hydroxyphenylboronic acid, 95%, (2,4,6-Trifluoro-3-hydroxyphenyl)boronic acid 98%, 2,4,6-Trifluoro-3-hydroxyphenylboronic acid, 98%, 98%, (2,4,6-Trifluoro-3-hydroxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2,4,6-trifluoro-3-hydroxyphenyl)boronic acid (CAS 1072951-37-1) is a chemical compound with the molecular formula C6H4BF3O3 and a molecular weight of 191.90 g/mol. IUPAC name: (2,4,6-trifluoro-3-hydroxyphenyl)boronic acid. InChIKey: LKUKEGVNXUPRQC-UHFFFAOYSA-N.
| Molecular formula | C6H4BF3O3 |
|---|---|
| Molecular weight | 191.90 g/mol |
| IUPAC name | (2,4,6-trifluoro-3-hydroxyphenyl)boronic acid |
| InChIKey | LKUKEGVNXUPRQC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)F)O)F)(O)O |
Computed by PubChem (NCBI)