cas: 1256354-98-9 — see every product listed under this CAS number, including other names
(2,4-Bis(methoxycarbonyl)phenyl)boronic acid, 98%, 98% (CAS 1256354-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O3W-100mg |
| cas | 1256354-98-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 1758.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2,4-bis(methoxycarbonyl)phenyl]boronic acid (CAS 1256354-98-9) is a chemical compound with the molecular formula C10H11BO6 and a molecular weight of 238.00 g/mol. IUPAC name: [2,4-bis(methoxycarbonyl)phenyl]boronic acid. InChIKey: BUXKKSVFGRKVGD-UHFFFAOYSA-N.
| Molecular formula | C10H11BO6 |
|---|---|
| Molecular weight | 238.00 g/mol |
| IUPAC name | [2,4-bis(methoxycarbonyl)phenyl]boronic acid |
| InChIKey | BUXKKSVFGRKVGD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)