CAS 177735-55-6 appears in our catalog under these names: 3,5-Bis(methoxycarbonyl)phenylboronic acid, 96%, 3,5-Bis(methoxycarbonyl)benzeneboronic acid, 97% , (3,5-Bis(methoxycarbonyl)phenyl)boronic acid, 97%, 97%, (3,5-Bis(methoxycarbonyl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100g.
[3,5-bis(methoxycarbonyl)phenyl]boronic acid (CAS 177735-55-6) is a chemical compound with the molecular formula C10H11BO6 and a molecular weight of 238.00 g/mol. IUPAC name: [3,5-bis(methoxycarbonyl)phenyl]boronic acid. InChIKey: WEJWFDLAZSVCJK-UHFFFAOYSA-N.
| Molecular formula | C10H11BO6 |
|---|---|
| Molecular weight | 238.00 g/mol |
| IUPAC name | [3,5-bis(methoxycarbonyl)phenyl]boronic acid |
| InChIKey | WEJWFDLAZSVCJK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)