cas: 109299-79-8 — see every product listed under this CAS number, including other names
(2,4-Di-tert-butoxypyrimidin-5-yl)boronic acid 98% (CAS 109299-79-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A603758-250mg |
| cas | 109299-79-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 403.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A603758 |
[2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid (CAS 109299-79-8) is a chemical compound with the molecular formula C12H21BN2O4 and a molecular weight of 268.12 g/mol. IUPAC name: [2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid. InChIKey: SOJAZSRAXNFWRH-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O4 |
|---|---|
| Molecular weight | 268.12 g/mol |
| IUPAC name | [2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid |
| InChIKey | SOJAZSRAXNFWRH-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1OC(C)(C)C)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)