cas: 109299-79-8 — see every product listed under this CAS number, including other names
(2,4-Di-tert-butoxypyrimidin-5-yl)boronic acid, 98% (CAS 109299-79-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F862586-1G |
| cas | 109299-79-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 10g | 1721.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid (CAS 109299-79-8) is a chemical compound with the molecular formula C12H21BN2O4 and a molecular weight of 268.12 g/mol. IUPAC name: [2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid. InChIKey: SOJAZSRAXNFWRH-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O4 |
|---|---|
| Molecular weight | 268.12 g/mol |
| IUPAC name | [2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid |
| InChIKey | SOJAZSRAXNFWRH-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1OC(C)(C)C)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)