cas: 7554-79-2 — see every product listed under this CAS number, including other names
(2,4-Dichloro-benzoylamino)-acetic acid, 97% (CAS 7554-79-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F343532-1G |
| cas | 7554-79-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 914.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[(2,4-dichlorobenzoyl)amino]acetic acid (CAS 7554-79-2) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 2-[(2,4-dichlorobenzoyl)amino]acetic acid. InChIKey: NSEWCAZRGRZTHU-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | 2-[(2,4-dichlorobenzoyl)amino]acetic acid |
| InChIKey | NSEWCAZRGRZTHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)