CAS 14422-50-5 appears in our catalog under these names: 5-Chloro-2-(2-chloroacetamido)benzoic acid, 5-Chloro-2-[(chloroacetyl)amino]benzoic acid, 95%, 5-Chloro-2-(2-chloroacetamido)benzoic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 5g, 1g, 10g, 100mg.
5-chloro-2-[(2-chloroacetyl)amino]benzoic acid (CAS 14422-50-5) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 5-chloro-2-[(2-chloroacetyl)amino]benzoic acid. InChIKey: SMIHPRXPZTUBDT-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | 5-chloro-2-[(2-chloroacetyl)amino]benzoic acid |
| InChIKey | SMIHPRXPZTUBDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)NC(=O)CCl |
Computed by PubChem (NCBI)