cas: 771582-21-9 — see every product listed under this CAS number, including other names
(2,5-Bis(trifluoromethyl)phenyl)methanamine 98% (CAS 771582-21-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A952603-100mg |
| cas | 771582-21-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 754.19 Pln | |
| Ambeed | 1g | 1916.75 Pln | |
| Ambeed | 5g | 5615.81 Pln | |
| Ambeed | 10g | 8947.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A952603 |
[2,5-bis(trifluoromethyl)phenyl]methanamine (CAS 771582-21-9) is a chemical compound with the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. IUPAC name: [2,5-bis(trifluoromethyl)phenyl]methanamine. InChIKey: IFPBPVAFNHXNFN-UHFFFAOYSA-N.
| Molecular formula | C9H7F6N |
|---|---|
| Molecular weight | 243.15 g/mol |
| IUPAC name | [2,5-bis(trifluoromethyl)phenyl]methanamine |
| InChIKey | IFPBPVAFNHXNFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CN)C(F)(F)F |
Computed by PubChem (NCBI)