CAS 286010-20-6 is the registry number for 2,4-Bis(trifluoromethyl)benzylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[2,4-bis(trifluoromethyl)phenyl]methanamine (CAS 286010-20-6) is a chemical compound with the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. IUPAC name: [2,4-bis(trifluoromethyl)phenyl]methanamine. InChIKey: UOECFUQLAZNQIL-UHFFFAOYSA-N.
| Molecular formula | C9H7F6N |
|---|---|
| Molecular weight | 243.15 g/mol |
| IUPAC name | [2,4-bis(trifluoromethyl)phenyl]methanamine |
| InChIKey | UOECFUQLAZNQIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CN |
Computed by PubChem (NCBI)