cas: 1056162-06-1 — see every product listed under this CAS number, including other names
(2–(Trifluoromethyl)pyridin–3–yl)methanamine (CAS 1056162-06-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF53574-100mg |
| cas | 1056162-06-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 629.80 Pln | |
| GLPBio | 1g | 1233.59 Pln | |
| GLPBio | 250mg | 746.82 Pln | |
| GLPBio | 5g | 2483.28 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-(trifluoromethyl)-3-pyridinyl]methanamine (CAS 1056162-06-1) is a chemical compound with the molecular formula C7H7F3N2 and a molecular weight of 176.14 g/mol. IUPAC name: [2-(trifluoromethyl)-3-pyridinyl]methanamine. InChIKey: VTJMYVYYDDHHSP-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2 |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | [2-(trifluoromethyl)-3-pyridinyl]methanamine |
| InChIKey | VTJMYVYYDDHHSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(F)(F)F)CN |
Computed by PubChem (NCBI)