CAS 912761-24-1 appears in our catalog under these names: 2,2,2-Trifluoro-1-(pyridin-3-yl)ethanamine, 95%, 2,2,2-Trifluoro-1-(pyridin-3-yl)ethanamine 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
2,2,2-trifluoro-1-pyridin-3-ylethanamine (CAS 912761-24-1) is a chemical compound with the molecular formula C7H7F3N2 and a molecular weight of 176.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-pyridin-3-ylethanamine. InChIKey: ROWMBYANNAKARY-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2 |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-pyridin-3-ylethanamine |
| InChIKey | ROWMBYANNAKARY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(C(F)(F)F)N |
Computed by PubChem (NCBI)