cas: 2415163-55-0 — see every product listed under this CAS number, including other names
(2-((tert-Butoxycarbonyl)amino)-7-fluorobenzo[d]thiazol-4-yl)boronic acid 97% (CAS 2415163-55-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1362869-100mg |
| cas | 2415163-55-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 1160.25 Pln | |
| Ambeed | 5g | 3346.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1362869 |
[7-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid (CAS 2415163-55-0) is a chemical compound with the molecular formula C12H14BFN2O4S and a molecular weight of 312.13 g/mol. IUPAC name: [7-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid. InChIKey: ZQDPDWALEXQWLI-UHFFFAOYSA-N.
| Molecular formula | C12H14BFN2O4S |
|---|---|
| Molecular weight | 312.13 g/mol |
| IUPAC name | [7-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid |
| InChIKey | ZQDPDWALEXQWLI-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=C(C=C1)F)SC(=N2)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)