cas: 887344-38-9 — see every product listed under this CAS number, including other names
(2-(3,4-Dichlorophenyl)phenyl)sulfonyl chloride, 95% (CAS 887344-38-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A684071-1g |
| cas | 887344-38-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6345.64 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(3,4-dichlorophenyl)benzenesulfonyl chloride (CAS 887344-38-9) is a chemical compound with the molecular formula C12H7Cl3O2S and a molecular weight of 321.6 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)benzenesulfonyl chloride. InChIKey: NKNFGTZKGUVHGA-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3O2S |
|---|---|
| Molecular weight | 321.6 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)benzenesulfonyl chloride |
| InChIKey | NKNFGTZKGUVHGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)